C14H19ClN6O — CID 117082328
1-[2-[2-chloro-6-(propylamino)purin-9-yl]ethyl]pyrrolidin-2-one (PubChem CID 117082328) has the molecular formula C14H19ClN6O and a molecular weight of 322.80 g/mol. Its IUPAC name is 1-[2-[2-chloro-6-(propylamino)purin-9-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[2-chloro-6-(propylamino)purin-9-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117082328 |
| Molecular Formula | C14H19ClN6O |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 1-[2-[2-chloro-6-(propylamino)purin-9-yl]ethyl]pyrrolidin-2-one |
| SMILES | CCCNc1nc(Cl)nc2c1ncn2CCN1CCCC1=O |
| InChI | InChI=1S/C14H19ClN6O/c1-2-5-16-12-11-13(19-14(15)18-12)21(9-17-11)8-7-20-6-3-4-10(20)22/h9H,2-8H2,1H3,(H,16,18,19) |
| InChIKey | PHGXAXVZWHPVKG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |