C23H27N9O2 — CID 117092064
1-[2-[2-[(2-methylpyrazol-3-yl)amino]-6-(2-phenoxyethylamino)purin-9-yl]ethyl]pyrrolidin-2-one (PubChem CID 117092064) has the molecular formula C23H27N9O2 and a molecular weight of 461.53 g/mol. Its IUPAC name is 1-[2-[2-[(2-methylpyrazol-3-yl)amino]-6-(2-phenoxyethylamino)purin-9-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[2-[(2-methylpyrazol-3-yl)amino]-6-(2-phenoxyethylamino)purin-9-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117092064 |
| Molecular Formula | C23H27N9O2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 1-[2-[2-[(2-methylpyrazol-3-yl)amino]-6-(2-phenoxyethylamino)purin-9-yl]ethyl]pyrrolidin-2-one |
| SMILES | Cn1nccc1Nc1nc(NCCOc2ccccc2)c2ncn(CCN3CCCC3=O)c2n1 |
| InChI | InChI=1S/C23H27N9O2/c1-30-18(9-10-26-30)27-23-28-21(24-11-15-34-17-6-3-2-4-7-17)20-22(29-23)32(16-25-20)14-13-31-12-5-8-19(31)33/h2-4,6-7,9-10,16H,5,8,11-15H2,1H3,(H2,24,27,28,29) |
| InChIKey | ICKSUPFDSPDJEF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|