C16H15ClF3N5 — CID 117084564
2-chloro-N-propyl-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine (PubChem CID 117084564) has the molecular formula C16H15ClF3N5 and a molecular weight of 369.78 g/mol. Its IUPAC name is 2-chloro-N-propyl-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine.
| Compound Name | 2-chloro-N-propyl-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 117084564 |
| Molecular Formula | C16H15ClF3N5 |
| Molecular Weight | 369.78 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-chloro-N-propyl-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine |
| SMILES | CCCNc1nc(Cl)nc2c1ncn2Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15ClF3N5/c1-2-7-21-13-12-14(24-15(17)23-13)25(9-22-12)8-10-3-5-11(6-4-10)16(18,19)20/h3-6,9H,2,7-8H2,1H3,(H,21,23,24) |
| InChIKey | IFQKVAKWWWTRKV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.78 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |