C20H15ClF3N5 — CID 24777799
N-benzyl-2-chloro-9-[[3-(trifluoromethyl)phenyl]methyl]purin-6-amine (PubChem CID 24777799) has the molecular formula C20H15ClF3N5 and a molecular weight of 417.82 g/mol. Its IUPAC name is N-benzyl-2-chloro-9-[[3-(trifluoromethyl)phenyl]methyl]purin-6-amine.
| Compound Name | N-benzyl-2-chloro-9-[[3-(trifluoromethyl)phenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 24777799 |
| Molecular Formula | C20H15ClF3N5 |
| Molecular Weight | 417.82 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-benzyl-2-chloro-9-[[3-(trifluoromethyl)phenyl]methyl]purin-6-amine |
| SMILES | FC(F)(F)c1cccc(Cn2cnc3c(NCc4ccccc4)nc(Cl)nc32)c1 |
| InChI | InChI=1S/C20H15ClF3N5/c21-19-27-17(25-10-13-5-2-1-3-6-13)16-18(28-19)29(12-26-16)11-14-7-4-8-15(9-14)20(22,23)24/h1-9,12H,10-11H2,(H,25,27,28) |
| InChIKey | ZZAFRPLFVKQMLA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.82 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |