C18H15Cl2N5 — CID 127258073
9-benzyl-2-chloro-N-phenylpurin-6-amine;hydrochloride (PubChem CID 127258073) has the molecular formula C18H15Cl2N5 and a molecular weight of 372.26 g/mol. Its IUPAC name is 9-benzyl-2-chloro-N-phenylpurin-6-amine;hydrochloride.
| Compound Name | 9-benzyl-2-chloro-N-phenylpurin-6-amine;hydrochloride |
|---|---|
| PubChem CID | 127258073 |
| Molecular Formula | C18H15Cl2N5 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 9-benzyl-2-chloro-N-phenylpurin-6-amine;hydrochloride |
| SMILES | Cl.Clc1nc(Nc2ccccc2)c2ncn(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C18H14ClN5.ClH/c19-18-22-16(21-14-9-5-2-6-10-14)15-17(23-18)24(12-20-15)11-13-7-3-1-4-8-13;/h1-10,12H,11H2,(H,21,22,23);1H |
| InChIKey | OQMABXXKKTZDON-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |