C27H25Cl3N8Sn — CID 161477758
(9-benzyl-2-chloropurin-6-yl)-trimethylstannane;9-benzyl-2,6-dichloropurine (PubChem CID 161477758) has the molecular formula C27H25Cl3N8Sn and a molecular weight of 686.62 g/mol. Its IUPAC name is (9-benzyl-2-chloropurin-6-yl)-trimethylstannane;9-benzyl-2,6-dichloropurine.
| Compound Name | (9-benzyl-2-chloropurin-6-yl)-trimethylstannane;9-benzyl-2,6-dichloropurine |
|---|---|
| PubChem CID | 161477758 |
| Molecular Formula | C27H25Cl3N8Sn |
| Molecular Weight | 686.62 g/mol |
| Exact Mass | 686.03 |
| IUPAC Name | (9-benzyl-2-chloropurin-6-yl)-trimethylstannane;9-benzyl-2,6-dichloropurine |
| SMILES | C[Sn](C)(C)c1nc(Cl)nc2c1ncn2Cc1ccccc1.Clc1nc(Cl)c2ncn(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C12H8Cl2N4.C12H8ClN4.3CH3.Sn/c13-10-9-11(17-12(14)16-10)18(7-15-9)6-8-4-2-1-3-5-8;13-12-14-6-10-11(16-12)17(8-15-10)7-9-4-2-1-3-5-9;;;;/h1-5,7H,6H2;1-5,8H,7H2;3*1H3; |
| InChIKey | WDYCLKZNTFKGFJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |