C20H16ClF2N5 — CID 89199326
N-benzyl-2-chloro-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine (PubChem CID 89199326) has the molecular formula C20H16ClF2N5 and a molecular weight of 399.83 g/mol. Its IUPAC name is N-benzyl-2-chloro-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine.
| Compound Name | N-benzyl-2-chloro-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 89199326 |
| Molecular Formula | C20H16ClF2N5 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-benzyl-2-chloro-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine |
| SMILES | Cc1ccc(F)c(Cn2cnc3c(NCc4ccccc4)nc(Cl)nc32)c1F |
| InChI | InChI=1S/C20H16ClF2N5/c1-12-7-8-15(22)14(16(12)23)10-28-11-25-17-18(26-20(21)27-19(17)28)24-9-13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H,24,26,27) |
| InChIKey | HYIUICLTPZXFQN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |