C21H19ClN6O2 — CID 121390711
4-[[2-chloro-6-[(4-methoxyphenyl)methylamino]purin-9-yl]methyl]benzamide (PubChem CID 121390711) has the molecular formula C21H19ClN6O2 and a molecular weight of 422.88 g/mol. Its IUPAC name is 4-[[2-chloro-6-[(4-methoxyphenyl)methylamino]purin-9-yl]methyl]benzamide.
| Compound Name | 4-[[2-chloro-6-[(4-methoxyphenyl)methylamino]purin-9-yl]methyl]benzamide |
|---|---|
| PubChem CID | 121390711 |
| Molecular Formula | C21H19ClN6O2 |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 4-[[2-chloro-6-[(4-methoxyphenyl)methylamino]purin-9-yl]methyl]benzamide |
| SMILES | COc1ccc(CNc2nc(Cl)nc3c2ncn3Cc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C21H19ClN6O2/c1-30-16-8-4-13(5-9-16)10-24-19-17-20(27-21(22)26-19)28(12-25-17)11-14-2-6-15(7-3-14)18(23)29/h2-9,12H,10-11H2,1H3,(H2,23,29)(H,24,26,27) |
| InChIKey | BOWSITVANNTRCW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |