C25H30N5O3P — CID 170722651
2-diethylphosphoryl-N,9-bis[(4-methoxyphenyl)methyl]purin-6-amine (PubChem CID 170722651) has the molecular formula C25H30N5O3P and a molecular weight of 479.52 g/mol. Its IUPAC name is 2-diethylphosphoryl-N,9-bis[(4-methoxyphenyl)methyl]purin-6-amine.
| Compound Name | 2-diethylphosphoryl-N,9-bis[(4-methoxyphenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 170722651 |
| Molecular Formula | C25H30N5O3P |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 2-diethylphosphoryl-N,9-bis[(4-methoxyphenyl)methyl]purin-6-amine |
| SMILES | CCP(=O)(CC)c1nc(NCc2ccc(OC)cc2)c2ncn(Cc3ccc(OC)cc3)c2n1 |
| InChI | InChI=1S/C25H30N5O3P/c1-5-34(31,6-2)25-28-23(26-15-18-7-11-20(32-3)12-8-18)22-24(29-25)30(17-27-22)16-19-9-13-21(33-4)14-10-19/h7-14,17H,5-6,15-16H2,1-4H3,(H,26,28,29) |
| InChIKey | DVEBYVGGYGPQLW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|