C23H26N5O3P — CID 170722633
2-dimethylphosphoryl-N,9-bis[(4-methoxyphenyl)methyl]purin-6-amine (PubChem CID 170722633) has the molecular formula C23H26N5O3P and a molecular weight of 451.47 g/mol. Its IUPAC name is 2-dimethylphosphoryl-N,9-bis[(4-methoxyphenyl)methyl]purin-6-amine.
| Compound Name | 2-dimethylphosphoryl-N,9-bis[(4-methoxyphenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 170722633 |
| Molecular Formula | C23H26N5O3P |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 2-dimethylphosphoryl-N,9-bis[(4-methoxyphenyl)methyl]purin-6-amine |
| SMILES | COc1ccc(CNc2nc(P(C)(C)=O)nc3c2ncn3Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H26N5O3P/c1-30-18-9-5-16(6-10-18)13-24-21-20-22(27-23(26-21)32(3,4)29)28(15-25-20)14-17-7-11-19(31-2)12-8-17/h5-12,15H,13-14H2,1-4H3,(H,24,26,27) |
| InChIKey | JEROBJFHNYEGDN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|