C17H20ClN5O2 — CID 18002244
2-chloro-N-[(3,4-dimethoxyphenyl)methyl]-9-propylpurin-6-amine (PubChem CID 18002244) has the molecular formula C17H20ClN5O2 and a molecular weight of 361.83 g/mol. Its IUPAC name is 2-chloro-N-[(3,4-dimethoxyphenyl)methyl]-9-propylpurin-6-amine.
| Compound Name | 2-chloro-N-[(3,4-dimethoxyphenyl)methyl]-9-propylpurin-6-amine |
|---|---|
| PubChem CID | 18002244 |
| Molecular Formula | C17H20ClN5O2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-chloro-N-[(3,4-dimethoxyphenyl)methyl]-9-propylpurin-6-amine |
| SMILES | CCCn1cnc2c(NCc3ccc(OC)c(OC)c3)nc(Cl)nc21 |
| InChI | InChI=1S/C17H20ClN5O2/c1-4-7-23-10-20-14-15(21-17(18)22-16(14)23)19-9-11-5-6-12(24-2)13(8-11)25-3/h5-6,8,10H,4,7,9H2,1-3H3,(H,19,21,22) |
| InChIKey | QBTZDNPFXMJLKA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |