C14H12Cl2N4O — CID 11151441
2,6-dichloro-9-[(4-methoxy-3-methylphenyl)methyl]purine (PubChem CID 11151441) has the molecular formula C14H12Cl2N4O and a molecular weight of 323.18 g/mol. Its IUPAC name is 2,6-dichloro-9-[(4-methoxy-3-methylphenyl)methyl]purine.
| Compound Name | 2,6-dichloro-9-[(4-methoxy-3-methylphenyl)methyl]purine |
|---|---|
| PubChem CID | 11151441 |
| Molecular Formula | C14H12Cl2N4O |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2,6-dichloro-9-[(4-methoxy-3-methylphenyl)methyl]purine |
| SMILES | COc1ccc(Cn2cnc3c(Cl)nc(Cl)nc32)cc1C |
| InChI | InChI=1S/C14H12Cl2N4O/c1-8-5-9(3-4-10(8)21-2)6-20-7-17-11-12(15)18-14(16)19-13(11)20/h3-5,7H,6H2,1-2H3 |
| InChIKey | IIZNDWBXGIEMTD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |