C15H16ClN5O — CID 3010194
2-chloro-9-[(3-methoxyphenyl)methyl]-N,N-dimethylpurin-6-amine (PubChem CID 3010194) has the molecular formula C15H16ClN5O and a molecular weight of 317.78 g/mol. Its IUPAC name is 2-chloro-9-[(3-methoxyphenyl)methyl]-N,N-dimethylpurin-6-amine.
| Compound Name | 2-chloro-9-[(3-methoxyphenyl)methyl]-N,N-dimethylpurin-6-amine |
|---|---|
| PubChem CID | 3010194 |
| Molecular Formula | C15H16ClN5O |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-chloro-9-[(3-methoxyphenyl)methyl]-N,N-dimethylpurin-6-amine |
| SMILES | COc1cccc(Cn2cnc3c(N(C)C)nc(Cl)nc32)c1 |
| InChI | InChI=1S/C15H16ClN5O/c1-20(2)13-12-14(19-15(16)18-13)21(9-17-12)8-10-5-4-6-11(7-10)22-3/h4-7,9H,8H2,1-3H3 |
| InChIKey | VVULAYVNBARNGS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |