C18H12Cl4N8O — CID 158330316
2,6-dichloro-9-[(4-methoxyphenyl)methyl]purine;2,6-dichloro-7H-purine (PubChem CID 158330316) has the molecular formula C18H12Cl4N8O and a molecular weight of 498.16 g/mol. Its IUPAC name is 2,6-dichloro-9-[(4-methoxyphenyl)methyl]purine;2,6-dichloro-7H-purine.
| Compound Name | 2,6-dichloro-9-[(4-methoxyphenyl)methyl]purine;2,6-dichloro-7H-purine |
|---|---|
| PubChem CID | 158330316 |
| Molecular Formula | C18H12Cl4N8O |
| Molecular Weight | 498.16 g/mol |
| Exact Mass | 495.99 |
| IUPAC Name | 2,6-dichloro-9-[(4-methoxyphenyl)methyl]purine;2,6-dichloro-7H-purine |
| SMILES | COc1ccc(Cn2cnc3c(Cl)nc(Cl)nc32)cc1.Clc1nc(Cl)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H10Cl2N4O.C5H2Cl2N4/c1-20-9-4-2-8(3-5-9)6-19-7-16-10-11(14)17-13(15)18-12(10)19;6-3-2-4(9-1-8-2)11-5(7)10-3/h2-5,7H,6H2,1H3;1H,(H,8,9,10,11) |
| InChIKey | GPXPCHDWFRUBHD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.16 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |