C5H3Cl2KN4 — CID 173320369
potassium;2,6-dichloro-7H-purine;hydride (PubChem CID 173320369) has the molecular formula C5H3Cl2KN4 and a molecular weight of 229.11 g/mol. Its IUPAC name is potassium;2,6-dichloro-7H-purine;hydride.
| Compound Name | potassium;2,6-dichloro-7H-purine;hydride |
|---|---|
| PubChem CID | 173320369 |
| Molecular Formula | C5H3Cl2KN4 |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 227.94 |
| IUPAC Name | potassium;2,6-dichloro-7H-purine;hydride |
| SMILES | Clc1nc(Cl)c2[nH]cnc2n1.[H-].[K+] |
| InChI | InChI=1S/C5H2Cl2N4.K.H/c6-3-2-4(9-1-8-2)11-5(7)10-3;;/h1H,(H,8,9,10,11);;/q;+1;-1 |
| InChIKey | AHEKJYZTZOERKH-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |