C12H8Cl2N4O2 — CID 155059371
benzoic acid;2,6-dichloro-7H-purine (PubChem CID 155059371) has the molecular formula C12H8Cl2N4O2 and a molecular weight of 311.13 g/mol. Its IUPAC name is benzoic acid;2,6-dichloro-7H-purine.
| Compound Name | benzoic acid;2,6-dichloro-7H-purine |
|---|---|
| PubChem CID | 155059371 |
| Molecular Formula | C12H8Cl2N4O2 |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | benzoic acid;2,6-dichloro-7H-purine |
| SMILES | Clc1nc(Cl)c2[nH]cnc2n1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C5H2Cl2N4/c8-7(9)6-4-2-1-3-5-6;6-3-2-4(9-1-8-2)11-5(7)10-3/h1-5H,(H,8,9);1H,(H,8,9,10,11) |
| InChIKey | BEUNBCUMHCAKFN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |