C16H9Cl3N10O2 — CID 159255333
2-chloro-N-(3-nitrophenyl)-7H-purin-6-amine;2,6-dichloro-7H-purine (PubChem CID 159255333) has the molecular formula C16H9Cl3N10O2 and a molecular weight of 479.68 g/mol. Its IUPAC name is 2-chloro-N-(3-nitrophenyl)-7H-purin-6-amine;2,6-dichloro-7H-purine.
| Compound Name | 2-chloro-N-(3-nitrophenyl)-7H-purin-6-amine;2,6-dichloro-7H-purine |
|---|---|
| PubChem CID | 159255333 |
| Molecular Formula | C16H9Cl3N10O2 |
| Molecular Weight | 479.68 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | 2-chloro-N-(3-nitrophenyl)-7H-purin-6-amine;2,6-dichloro-7H-purine |
| SMILES | Clc1nc(Cl)c2[nH]cnc2n1.O=[N+]([O-])c1cccc(Nc2nc(Cl)nc3nc[nH]c23)c1 |
| InChI | InChI=1S/C11H7ClN6O2.C5H2Cl2N4/c12-11-16-9-8(13-5-14-9)10(17-11)15-6-2-1-3-7(4-6)18(19)20;6-3-2-4(9-1-8-2)11-5(7)10-3/h1-5H,(H2,13,14,15,16,17);1H,(H,8,9,10,11) |
| InChIKey | KVUZTVRWSUOLHR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 164.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.68 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|