C14H14ClN5 — CID 104787073
2-chloro-N-(3-propan-2-ylphenyl)-7H-purin-6-amine (PubChem CID 104787073) has the molecular formula C14H14ClN5 and a molecular weight of 287.75 g/mol. Its IUPAC name is 2-chloro-N-(3-propan-2-ylphenyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-(3-propan-2-ylphenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 104787073 |
| Molecular Formula | C14H14ClN5 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-chloro-N-(3-propan-2-ylphenyl)-7H-purin-6-amine |
| SMILES | CC(C)c1cccc(Nc2nc(Cl)nc3nc[nH]c23)c1 |
| InChI | InChI=1S/C14H14ClN5/c1-8(2)9-4-3-5-10(6-9)18-13-11-12(17-7-16-11)19-14(15)20-13/h3-8H,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | QWTGTNGSDRQIFQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |