C11H6Cl2FN5 — CID 113442631
2-chloro-N-(3-chloro-4-fluorophenyl)-7H-purin-6-amine (PubChem CID 113442631) has the molecular formula C11H6Cl2FN5 and a molecular weight of 298.11 g/mol. Its IUPAC name is 2-chloro-N-(3-chloro-4-fluorophenyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-(3-chloro-4-fluorophenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 113442631 |
| Molecular Formula | C11H6Cl2FN5 |
| Molecular Weight | 298.11 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 2-chloro-N-(3-chloro-4-fluorophenyl)-7H-purin-6-amine |
| SMILES | Fc1ccc(Nc2nc(Cl)nc3nc[nH]c23)cc1Cl |
| InChI | InChI=1S/C11H6Cl2FN5/c12-6-3-5(1-2-7(6)14)17-10-8-9(16-4-15-8)18-11(13)19-10/h1-4H,(H2,15,16,17,18,19) |
| InChIKey | FOCRYPDEFCYYIN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.11 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |