C12H8ClF2N5 — CID 104787449
2-chloro-N-(2,6-difluoro-3-methylphenyl)-7H-purin-6-amine (PubChem CID 104787449) has the molecular formula C12H8ClF2N5 and a molecular weight of 295.68 g/mol. Its IUPAC name is 2-chloro-N-(2,6-difluoro-3-methylphenyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-(2,6-difluoro-3-methylphenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 104787449 |
| Molecular Formula | C12H8ClF2N5 |
| Molecular Weight | 295.68 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-chloro-N-(2,6-difluoro-3-methylphenyl)-7H-purin-6-amine |
| SMILES | Cc1ccc(F)c(Nc2nc(Cl)nc3nc[nH]c23)c1F |
| InChI | InChI=1S/C12H8ClF2N5/c1-5-2-3-6(14)8(7(5)15)18-11-9-10(17-4-16-9)19-12(13)20-11/h2-4H,1H3,(H2,16,17,18,19,20) |
| InChIKey | UWLRRVOTGQHOQH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |