C11H5ClF3N5 — CID 104787396
2-chloro-N-(2,4,6-trifluorophenyl)-7H-purin-6-amine (PubChem CID 104787396) has the molecular formula C11H5ClF3N5 and a molecular weight of 299.64 g/mol. Its IUPAC name is 2-chloro-N-(2,4,6-trifluorophenyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-(2,4,6-trifluorophenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 104787396 |
| Molecular Formula | C11H5ClF3N5 |
| Molecular Weight | 299.64 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 2-chloro-N-(2,4,6-trifluorophenyl)-7H-purin-6-amine |
| SMILES | Fc1cc(F)c(Nc2nc(Cl)nc3nc[nH]c23)c(F)c1 |
| InChI | InChI=1S/C11H5ClF3N5/c12-11-19-9-8(16-3-17-9)10(20-11)18-7-5(14)1-4(13)2-6(7)15/h1-3H,(H2,16,17,18,19,20) |
| InChIKey | NISDGMNFNRBUHP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.64 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |