C11H7BrClN5 — CID 25168953
N-(2-bromophenyl)-2-chloro-7H-purin-6-amine (PubChem CID 25168953) has the molecular formula C11H7BrClN5 and a molecular weight of 324.57 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-chloro-7H-purin-6-amine.
| Compound Name | N-(2-bromophenyl)-2-chloro-7H-purin-6-amine |
|---|---|
| PubChem CID | 25168953 |
| Molecular Formula | C11H7BrClN5 |
| Molecular Weight | 324.57 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | N-(2-bromophenyl)-2-chloro-7H-purin-6-amine |
| SMILES | Clc1nc(Nc2ccccc2Br)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H7BrClN5/c12-6-3-1-2-4-7(6)16-10-8-9(15-5-14-8)17-11(13)18-10/h1-5H,(H2,14,15,16,17,18) |
| InChIKey | ZFMFUEVXZJZRLL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |