C14H15BrN6 — CID 107638678
6-N-(3-bromo-2-methylphenyl)-2-N-ethyl-7H-purine-2,6-diamine (PubChem CID 107638678) has the molecular formula C14H15BrN6 and a molecular weight of 347.22 g/mol. Its IUPAC name is 6-N-(3-bromo-2-methylphenyl)-2-N-ethyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-(3-bromo-2-methylphenyl)-2-N-ethyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 107638678 |
| Molecular Formula | C14H15BrN6 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 6-N-(3-bromo-2-methylphenyl)-2-N-ethyl-7H-purine-2,6-diamine |
| SMILES | CCNc1nc(Nc2cccc(Br)c2C)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H15BrN6/c1-3-16-14-20-12-11(17-7-18-12)13(21-14)19-10-6-4-5-9(15)8(10)2/h4-7H,3H2,1-2H3,(H3,16,17,18,19,20,21) |
| InChIKey | AMRKRBZUHWRGLH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |