C13H12ClFN6 — CID 114783285
6-N-(2-chloro-4-fluorophenyl)-2-N-ethyl-7H-purine-2,6-diamine (PubChem CID 114783285) has the molecular formula C13H12ClFN6 and a molecular weight of 306.73 g/mol. Its IUPAC name is 6-N-(2-chloro-4-fluorophenyl)-2-N-ethyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-(2-chloro-4-fluorophenyl)-2-N-ethyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114783285 |
| Molecular Formula | C13H12ClFN6 |
| Molecular Weight | 306.73 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 6-N-(2-chloro-4-fluorophenyl)-2-N-ethyl-7H-purine-2,6-diamine |
| SMILES | CCNc1nc(Nc2ccc(F)cc2Cl)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H12ClFN6/c1-2-16-13-20-11-10(17-6-18-11)12(21-13)19-9-4-3-7(15)5-8(9)14/h3-6H,2H2,1H3,(H3,16,17,18,19,20,21) |
| InChIKey | RZIDLXCRTOYPSD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.73 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |