C12H12ClFN4 — CID 80757509
4-N-(2-chloro-4-fluorophenyl)-2-N-ethylpyrimidine-2,4-diamine (PubChem CID 80757509) has the molecular formula C12H12ClFN4 and a molecular weight of 266.71 g/mol. Its IUPAC name is 4-N-(2-chloro-4-fluorophenyl)-2-N-ethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-chloro-4-fluorophenyl)-2-N-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80757509 |
| Molecular Formula | C12H12ClFN4 |
| Molecular Weight | 266.71 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 4-N-(2-chloro-4-fluorophenyl)-2-N-ethylpyrimidine-2,4-diamine |
| SMILES | CCNc1nccc(Nc2ccc(F)cc2Cl)n1 |
| InChI | InChI=1S/C12H12ClFN4/c1-2-15-12-16-6-5-11(18-12)17-10-4-3-8(14)7-9(10)13/h3-7H,2H2,1H3,(H2,15,16,17,18) |
| InChIKey | NQLRCGIMYLSJKV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.71 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |