C13H12ClN5 — CID 80852171
4-chloro-3-[[2-(ethylamino)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 80852171) has the molecular formula C13H12ClN5 and a molecular weight of 273.73 g/mol. Its IUPAC name is 4-chloro-3-[[2-(ethylamino)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 4-chloro-3-[[2-(ethylamino)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 80852171 |
| Molecular Formula | C13H12ClN5 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 4-chloro-3-[[2-(ethylamino)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | CCNc1nccc(Nc2cc(C#N)ccc2Cl)n1 |
| InChI | InChI=1S/C13H12ClN5/c1-2-16-13-17-6-5-12(19-13)18-11-7-9(8-15)3-4-10(11)14/h3-7H,2H2,1H3,(H2,16,17,18,19) |
| InChIKey | BWBQZJWUGCOPSK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |