C15H20N4 — CID 80807590
2-N-ethyl-4-N-(2-propylphenyl)pyrimidine-2,4-diamine (PubChem CID 80807590) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-N-ethyl-4-N-(2-propylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-ethyl-4-N-(2-propylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80807590 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-N-ethyl-4-N-(2-propylphenyl)pyrimidine-2,4-diamine |
| SMILES | CCCc1ccccc1Nc1ccnc(NCC)n1 |
| InChI | InChI=1S/C15H20N4/c1-3-7-12-8-5-6-9-13(12)18-14-10-11-17-15(19-14)16-4-2/h5-6,8-11H,3-4,7H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | SGVLKNALAJZQOI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |