C16H22N4 — CID 80808085
2-N-ethyl-6-methyl-4-N-(2-propylphenyl)pyrimidine-2,4-diamine (PubChem CID 80808085) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-N-ethyl-6-methyl-4-N-(2-propylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-ethyl-6-methyl-4-N-(2-propylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80808085 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-N-ethyl-6-methyl-4-N-(2-propylphenyl)pyrimidine-2,4-diamine |
| SMILES | CCCc1ccccc1Nc1cc(C)nc(NCC)n1 |
| InChI | InChI=1S/C16H22N4/c1-4-8-13-9-6-7-10-14(13)19-15-11-12(3)18-16(20-15)17-5-2/h6-7,9-11H,4-5,8H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | RBXPMQJOPZIBDA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |