C12H10Br2N6 — CID 107604396
6-N-(2,6-dibromophenyl)-2-N-methyl-7H-purine-2,6-diamine (PubChem CID 107604396) has the molecular formula C12H10Br2N6 and a molecular weight of 398.06 g/mol. Its IUPAC name is 6-N-(2,6-dibromophenyl)-2-N-methyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-(2,6-dibromophenyl)-2-N-methyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 107604396 |
| Molecular Formula | C12H10Br2N6 |
| Molecular Weight | 398.06 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | 6-N-(2,6-dibromophenyl)-2-N-methyl-7H-purine-2,6-diamine |
| SMILES | CNc1nc(Nc2c(Br)cccc2Br)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H10Br2N6/c1-15-12-19-10-9(16-5-17-10)11(20-12)18-8-6(13)3-2-4-7(8)14/h2-5H,1H3,(H3,15,16,17,18,19,20) |
| InChIKey | HKBNHJDAEUUQOS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.06 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |