C12H10ClIN6 — CID 107639033
6-N-(4-chloro-2-iodophenyl)-2-N-methyl-7H-purine-2,6-diamine (PubChem CID 107639033) has the molecular formula C12H10ClIN6 and a molecular weight of 400.61 g/mol. Its IUPAC name is 6-N-(4-chloro-2-iodophenyl)-2-N-methyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-(4-chloro-2-iodophenyl)-2-N-methyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 107639033 |
| Molecular Formula | C12H10ClIN6 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 6-N-(4-chloro-2-iodophenyl)-2-N-methyl-7H-purine-2,6-diamine |
| SMILES | CNc1nc(Nc2ccc(Cl)cc2I)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H10ClIN6/c1-15-12-19-10-9(16-5-17-10)11(20-12)18-8-3-2-6(13)4-7(8)14/h2-5H,1H3,(H3,15,16,17,18,19,20) |
| InChIKey | LKWVCEJUFASQTJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|