C12H9BrClN5O — CID 114787330
6-(2-bromo-4-chlorophenoxy)-N-methyl-7H-purin-2-amine (PubChem CID 114787330) has the molecular formula C12H9BrClN5O and a molecular weight of 354.60 g/mol. Its IUPAC name is 6-(2-bromo-4-chlorophenoxy)-N-methyl-7H-purin-2-amine.
| Compound Name | 6-(2-bromo-4-chlorophenoxy)-N-methyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114787330 |
| Molecular Formula | C12H9BrClN5O |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 6-(2-bromo-4-chlorophenoxy)-N-methyl-7H-purin-2-amine |
| SMILES | CNc1nc(Oc2ccc(Cl)cc2Br)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H9BrClN5O/c1-15-12-18-10-9(16-5-17-10)11(19-12)20-8-3-2-6(14)4-7(8)13/h2-5H,1H3,(H2,15,16,17,18,19) |
| InChIKey | IMLRZKMJVKTZLA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |