C12H8BrF2N5O — CID 107102588
6-(5-bromo-2,3-difluorophenoxy)-N-methyl-7H-purin-2-amine (PubChem CID 107102588) has the molecular formula C12H8BrF2N5O and a molecular weight of 356.13 g/mol. Its IUPAC name is 6-(5-bromo-2,3-difluorophenoxy)-N-methyl-7H-purin-2-amine.
| Compound Name | 6-(5-bromo-2,3-difluorophenoxy)-N-methyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 107102588 |
| Molecular Formula | C12H8BrF2N5O |
| Molecular Weight | 356.13 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 6-(5-bromo-2,3-difluorophenoxy)-N-methyl-7H-purin-2-amine |
| SMILES | CNc1nc(Oc2cc(Br)cc(F)c2F)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H8BrF2N5O/c1-16-12-19-10-9(17-4-18-10)11(20-12)21-7-3-5(13)2-6(14)8(7)15/h2-4H,1H3,(H2,16,17,18,19,20) |
| InChIKey | XYDDEKROFDVYOR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.13 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|