C11H8BrF2N3O3 — CID 107099157
2-(5-bromo-2,3-difluorophenoxy)-4,6-dimethoxy-1,3,5-triazine (PubChem CID 107099157) has the molecular formula C11H8BrF2N3O3 and a molecular weight of 348.10 g/mol. Its IUPAC name is 2-(5-bromo-2,3-difluorophenoxy)-4,6-dimethoxy-1,3,5-triazine.
| Compound Name | 2-(5-bromo-2,3-difluorophenoxy)-4,6-dimethoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 107099157 |
| Molecular Formula | C11H8BrF2N3O3 |
| Molecular Weight | 348.10 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | 2-(5-bromo-2,3-difluorophenoxy)-4,6-dimethoxy-1,3,5-triazine |
| SMILES | COc1nc(OC)nc(Oc2cc(Br)cc(F)c2F)n1 |
| InChI | InChI=1S/C11H8BrF2N3O3/c1-18-9-15-10(19-2)17-11(16-9)20-7-4-5(12)3-6(13)8(7)14/h3-4H,1-2H3 |
| InChIKey | FDPYQYHWDNECLE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.10 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|