C12H15BrF2O — CID 107098584
5-bromo-1-(3,3-dimethylbutoxy)-2,3-difluorobenzene (PubChem CID 107098584) has the molecular formula C12H15BrF2O and a molecular weight of 293.15 g/mol. Its IUPAC name is 5-bromo-1-(3,3-dimethylbutoxy)-2,3-difluorobenzene.
| Compound Name | 5-bromo-1-(3,3-dimethylbutoxy)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 107098584 |
| Molecular Formula | C12H15BrF2O |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 5-bromo-1-(3,3-dimethylbutoxy)-2,3-difluorobenzene |
| SMILES | CC(C)(C)CCOc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C12H15BrF2O/c1-12(2,3)4-5-16-10-7-8(13)6-9(14)11(10)15/h6-7H,4-5H2,1-3H3 |
| InChIKey | JJJKDZDMOHLKBO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|