C16H23BrF2O — CID 107098815
5-bromo-1-decoxy-2,3-difluorobenzene (PubChem CID 107098815) has the molecular formula C16H23BrF2O and a molecular weight of 349.26 g/mol. Its IUPAC name is 5-bromo-1-decoxy-2,3-difluorobenzene.
| Compound Name | 5-bromo-1-decoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 107098815 |
| Molecular Formula | C16H23BrF2O |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 5-bromo-1-decoxy-2,3-difluorobenzene |
| SMILES | CCCCCCCCCCOc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C16H23BrF2O/c1-2-3-4-5-6-7-8-9-10-20-15-12-13(17)11-14(18)16(15)19/h11-12H,2-10H2,1H3 |
| InChIKey | GJUOOVNQEMOSCN-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|