C9H6BrF5O — CID 107098938
5-bromo-1,2-difluoro-3-(3,3,3-trifluoropropoxy)benzene (PubChem CID 107098938) has the molecular formula C9H6BrF5O and a molecular weight of 305.04 g/mol. Its IUPAC name is 5-bromo-1,2-difluoro-3-(3,3,3-trifluoropropoxy)benzene.
| Compound Name | 5-bromo-1,2-difluoro-3-(3,3,3-trifluoropropoxy)benzene |
|---|---|
| PubChem CID | 107098938 |
| Molecular Formula | C9H6BrF5O |
| Molecular Weight | 305.04 g/mol |
| Exact Mass | 303.95 |
| IUPAC Name | 5-bromo-1,2-difluoro-3-(3,3,3-trifluoropropoxy)benzene |
| SMILES | Fc1cc(Br)cc(OCCC(F)(F)F)c1F |
| InChI | InChI=1S/C9H6BrF5O/c10-5-3-6(11)8(12)7(4-5)16-2-1-9(13,14)15/h3-4H,1-2H2 |
| InChIKey | NSJQBTMGHKMJNU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.04 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|