C10H8BrF5O — CID 107098654
5-bromo-1,2-difluoro-3-(4,4,4-trifluorobutoxy)benzene (PubChem CID 107098654) has the molecular formula C10H8BrF5O and a molecular weight of 319.07 g/mol. Its IUPAC name is 5-bromo-1,2-difluoro-3-(4,4,4-trifluorobutoxy)benzene.
| Compound Name | 5-bromo-1,2-difluoro-3-(4,4,4-trifluorobutoxy)benzene |
|---|---|
| PubChem CID | 107098654 |
| Molecular Formula | C10H8BrF5O |
| Molecular Weight | 319.07 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | 5-bromo-1,2-difluoro-3-(4,4,4-trifluorobutoxy)benzene |
| SMILES | Fc1cc(Br)cc(OCCCC(F)(F)F)c1F |
| InChI | InChI=1S/C10H8BrF5O/c11-6-4-7(12)9(13)8(5-6)17-3-1-2-10(14,15)16/h4-5H,1-3H2 |
| InChIKey | XEYCPBJWJLIXTM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.07 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|