C8H6BrF2NOS — CID 107098426
2-(5-bromo-2,3-difluorophenoxy)ethanethioamide (PubChem CID 107098426) has the molecular formula C8H6BrF2NOS and a molecular weight of 282.11 g/mol. Its IUPAC name is 2-(5-bromo-2,3-difluorophenoxy)ethanethioamide.
| Compound Name | 2-(5-bromo-2,3-difluorophenoxy)ethanethioamide |
|---|---|
| PubChem CID | 107098426 |
| Molecular Formula | C8H6BrF2NOS |
| Molecular Weight | 282.11 g/mol |
| Exact Mass | 280.93 |
| IUPAC Name | 2-(5-bromo-2,3-difluorophenoxy)ethanethioamide |
| SMILES | NC(=S)COc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C8H6BrF2NOS/c9-4-1-5(10)8(11)6(2-4)13-3-7(12)14/h1-2H,3H2,(H2,12,14) |
| InChIKey | USANNMKXUHCPAD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.11 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|