C12H7BrF2N2OS — CID 107098345
5-(5-bromo-2,3-difluorophenoxy)pyridine-2-carbothioamide (PubChem CID 107098345) has the molecular formula C12H7BrF2N2OS and a molecular weight of 345.17 g/mol. Its IUPAC name is 5-(5-bromo-2,3-difluorophenoxy)pyridine-2-carbothioamide.
| Compound Name | 5-(5-bromo-2,3-difluorophenoxy)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 107098345 |
| Molecular Formula | C12H7BrF2N2OS |
| Molecular Weight | 345.17 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | 5-(5-bromo-2,3-difluorophenoxy)pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ccc(Oc2cc(Br)cc(F)c2F)cn1 |
| InChI | InChI=1S/C12H7BrF2N2OS/c13-6-3-8(14)11(15)10(4-6)18-7-1-2-9(12(16)19)17-5-7/h1-5H,(H2,16,19) |
| InChIKey | NAJNOFZCQCRIIX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.17 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|