C12H8Cl2N2OS — CID 115488843
5-(2,4-dichlorophenoxy)pyridine-2-carbothioamide (PubChem CID 115488843) has the molecular formula C12H8Cl2N2OS and a molecular weight of 299.18 g/mol. Its IUPAC name is 5-(2,4-dichlorophenoxy)pyridine-2-carbothioamide.
| Compound Name | 5-(2,4-dichlorophenoxy)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 115488843 |
| Molecular Formula | C12H8Cl2N2OS |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | 5-(2,4-dichlorophenoxy)pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ccc(Oc2ccc(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C12H8Cl2N2OS/c13-7-1-4-11(9(14)5-7)17-8-2-3-10(12(15)18)16-6-8/h1-6H,(H2,15,18) |
| InChIKey | KOEPQQZAXZNNIK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|