C13H6BrF4NOS — CID 107098392
4-(5-bromo-2,3-difluorophenoxy)-3,5-difluorobenzenecarbothioamide (PubChem CID 107098392) has the molecular formula C13H6BrF4NOS and a molecular weight of 380.16 g/mol. Its IUPAC name is 4-(5-bromo-2,3-difluorophenoxy)-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-(5-bromo-2,3-difluorophenoxy)-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107098392 |
| Molecular Formula | C13H6BrF4NOS |
| Molecular Weight | 380.16 g/mol |
| Exact Mass | 378.93 |
| IUPAC Name | 4-(5-bromo-2,3-difluorophenoxy)-3,5-difluorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)c(Oc2cc(Br)cc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C13H6BrF4NOS/c14-6-3-7(15)11(18)10(4-6)20-12-8(16)1-5(13(19)21)2-9(12)17/h1-4H,(H2,19,21) |
| InChIKey | FGXDVZHNNXOHCN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.16 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|