C8H7BrF2N2O — CID 107099812
2-(5-bromo-2,3-difluorophenoxy)ethanimidamide (PubChem CID 107099812) has the molecular formula C8H7BrF2N2O and a molecular weight of 265.06 g/mol. Its IUPAC name is 2-(5-bromo-2,3-difluorophenoxy)ethanimidamide.
| Compound Name | 2-(5-bromo-2,3-difluorophenoxy)ethanimidamide |
|---|---|
| PubChem CID | 107099812 |
| Molecular Formula | C8H7BrF2N2O |
| Molecular Weight | 265.06 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | 2-(5-bromo-2,3-difluorophenoxy)ethanimidamide |
| SMILES | [H]/N=C(\N)COc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C8H7BrF2N2O/c9-4-1-5(10)8(11)6(2-4)14-3-7(12)13/h1-2H,3H2,(H3,12,13) |
| InChIKey | VERPWMUOTWZZAQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.06 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|