C10H11BrF2N2O — CID 107099813
2-(5-bromo-2,3-difluorophenoxy)butanimidamide (PubChem CID 107099813) has the molecular formula C10H11BrF2N2O and a molecular weight of 293.11 g/mol. Its IUPAC name is 2-(5-bromo-2,3-difluorophenoxy)butanimidamide.
| Compound Name | 2-(5-bromo-2,3-difluorophenoxy)butanimidamide |
|---|---|
| PubChem CID | 107099813 |
| Molecular Formula | C10H11BrF2N2O |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 2-(5-bromo-2,3-difluorophenoxy)butanimidamide |
| SMILES | [H]/N=C(\N)C(CC)Oc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C10H11BrF2N2O/c1-2-7(10(14)15)16-8-4-5(11)3-6(12)9(8)13/h3-4,7H,2H2,1H3,(H3,14,15) |
| InChIKey | VDTYINMOTXOQSV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|