C14H14BrF2NO2 — CID 107097759
1-(5-bromo-2,3-difluorophenoxy)-1-(furan-2-yl)butan-2-amine (PubChem CID 107097759) has the molecular formula C14H14BrF2NO2 and a molecular weight of 346.17 g/mol. Its IUPAC name is 1-(5-bromo-2,3-difluorophenoxy)-1-(furan-2-yl)butan-2-amine.
| Compound Name | 1-(5-bromo-2,3-difluorophenoxy)-1-(furan-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 107097759 |
| Molecular Formula | C14H14BrF2NO2 |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 1-(5-bromo-2,3-difluorophenoxy)-1-(furan-2-yl)butan-2-amine |
| SMILES | CCC(N)C(Oc1cc(Br)cc(F)c1F)c1ccco1 |
| InChI | InChI=1S/C14H14BrF2NO2/c1-2-10(18)14(11-4-3-5-19-11)20-12-7-8(15)6-9(16)13(12)17/h3-7,10,14H,2,18H2,1H3 |
| InChIKey | RCCLJRXKYLZELJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|