C10H9BrF5NO — CID 107097736
3-(5-bromo-2,3-difluorophenoxy)-4,4,4-trifluorobutan-2-amine (PubChem CID 107097736) has the molecular formula C10H9BrF5NO and a molecular weight of 334.08 g/mol. Its IUPAC name is 3-(5-bromo-2,3-difluorophenoxy)-4,4,4-trifluorobutan-2-amine.
| Compound Name | 3-(5-bromo-2,3-difluorophenoxy)-4,4,4-trifluorobutan-2-amine |
|---|---|
| PubChem CID | 107097736 |
| Molecular Formula | C10H9BrF5NO |
| Molecular Weight | 334.08 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 3-(5-bromo-2,3-difluorophenoxy)-4,4,4-trifluorobutan-2-amine |
| SMILES | CC(N)C(Oc1cc(Br)cc(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C10H9BrF5NO/c1-4(17)9(10(14,15)16)18-7-3-5(11)2-6(12)8(7)13/h2-4,9H,17H2,1H3 |
| InChIKey | TWHGQXSNBBXFSO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.08 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|