C10H10ClF4NO — CID 116688803
3-(3-chloro-2-fluorophenoxy)-4,4,4-trifluorobutan-2-amine (PubChem CID 116688803) has the molecular formula C10H10ClF4NO and a molecular weight of 271.64 g/mol. Its IUPAC name is 3-(3-chloro-2-fluorophenoxy)-4,4,4-trifluorobutan-2-amine.
| Compound Name | 3-(3-chloro-2-fluorophenoxy)-4,4,4-trifluorobutan-2-amine |
|---|---|
| PubChem CID | 116688803 |
| Molecular Formula | C10H10ClF4NO |
| Molecular Weight | 271.64 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 3-(3-chloro-2-fluorophenoxy)-4,4,4-trifluorobutan-2-amine |
| SMILES | CC(N)C(Oc1cccc(Cl)c1F)C(F)(F)F |
| InChI | InChI=1S/C10H10ClF4NO/c1-5(16)9(10(13,14)15)17-7-4-2-3-6(11)8(7)12/h2-5,9H,16H2,1H3 |
| InChIKey | ZOYYRJOJDYXOHB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |