C11H13F4NO — CID 107656388
4,4,4-trifluoro-3-(2-fluoro-3-methylphenoxy)butan-2-amine (PubChem CID 107656388) has the molecular formula C11H13F4NO and a molecular weight of 251.22 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(2-fluoro-3-methylphenoxy)butan-2-amine.
| Compound Name | 4,4,4-trifluoro-3-(2-fluoro-3-methylphenoxy)butan-2-amine |
|---|---|
| PubChem CID | 107656388 |
| Molecular Formula | C11H13F4NO |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 4,4,4-trifluoro-3-(2-fluoro-3-methylphenoxy)butan-2-amine |
| SMILES | Cc1cccc(OC(C(C)N)C(F)(F)F)c1F |
| InChI | InChI=1S/C11H13F4NO/c1-6-4-3-5-8(9(6)12)17-10(7(2)16)11(13,14)15/h3-5,7,10H,16H2,1-2H3 |
| InChIKey | GXAGYMYRVXSYOQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |