About chloromethane;2-fluoro-1,3-dimethylbenzene
chloromethane;2-fluoro-1,3-dimethylbenzene (PubChem CID 144572529) has the molecular formula C9H12ClF
and a molecular weight of 174.65 g/mol. Its IUPAC name is chloromethane;2-fluoro-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | chloromethane;2-fluoro-1,3-dimethylbenzene |
| PubChem CID | 144572529 |
| Molecular Formula | C9H12ClF |
| Molecular Weight | 174.65 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | chloromethane;2-fluoro-1,3-dimethylbenzene |
| SMILES | CCl.Cc1cccc(C)c1F |
| InChI | InChI=1S/C8H9F.CH3Cl/c1-6-4-3-5-7(2)8(6)9;1-2/h3-5H,1-2H3;1H3 |
| InChIKey | JYJLCCMWXQOPHE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;2-fluoro-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;2-fluoro-1,3-dimethylbenzene?
The IUPAC name of chloromethane;2-fluoro-1,3-dimethylbenzene (CID 144572529) is chloromethane;2-fluoro-1,3-dimethylbenzene.
What is the SMILES notation for chloromethane;2-fluoro-1,3-dimethylbenzene?
The canonical SMILES for chloromethane;2-fluoro-1,3-dimethylbenzene is CCl.Cc1cccc(C)c1F.
What is the InChIKey of chloromethane;2-fluoro-1,3-dimethylbenzene?
The InChIKey is JYJLCCMWXQOPHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F.CH3Cl/c1-6-4-3-5-7(2)8(6)9;1-2/h3-5H,1-2H3;1H3.
What are the key properties of chloromethane;2-fluoro-1,3-dimethylbenzene?
chloromethane;2-fluoro-1,3-dimethylbenzene has a molecular weight of 174.65 g/mol, XLogP of 3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;2-fluoro-1,3-dimethylbenzene is sourced from PubChem (CID 144572529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).