About 1-chloro-2-fluoro-3-methylbenzene;diiodozinc
1-chloro-2-fluoro-3-methylbenzene;diiodozinc (PubChem CID 174784139) has the molecular formula C7H6ClFI2Zn
and a molecular weight of 463.77 g/mol. Its IUPAC name is 1-chloro-2-fluoro-3-methylbenzene;diiodozinc.
Molecular Properties
| Compound Name | 1-chloro-2-fluoro-3-methylbenzene;diiodozinc |
| PubChem CID | 174784139 |
| Molecular Formula | C7H6ClFI2Zn |
| Molecular Weight | 463.77 g/mol |
| Exact Mass | 461.75 |
| IUPAC Name | 1-chloro-2-fluoro-3-methylbenzene;diiodozinc |
| SMILES | Cc1cccc(Cl)c1F.I[Zn]I |
| InChI | InChI=1S/C7H6ClF.2HI.Zn/c1-5-3-2-4-6(8)7(5)9;;;/h2-4H,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | YXCWOFPDCKRZOK-UHFFFAOYSA-L |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.77 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-fluoro-3-methylbenzene;diiodozinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-fluoro-3-methylbenzene;diiodozinc?
The IUPAC name of 1-chloro-2-fluoro-3-methylbenzene;diiodozinc (CID 174784139) is 1-chloro-2-fluoro-3-methylbenzene;diiodozinc.
What is the SMILES notation for 1-chloro-2-fluoro-3-methylbenzene;diiodozinc?
The canonical SMILES for 1-chloro-2-fluoro-3-methylbenzene;diiodozinc is Cc1cccc(Cl)c1F.I[Zn]I.
What is the InChIKey of 1-chloro-2-fluoro-3-methylbenzene;diiodozinc?
The InChIKey is YXCWOFPDCKRZOK-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6ClF.2HI.Zn/c1-5-3-2-4-6(8)7(5)9;;;/h2-4H,1H3;2*1H;/q;;;+2/p-2.
What are the key properties of 1-chloro-2-fluoro-3-methylbenzene;diiodozinc?
1-chloro-2-fluoro-3-methylbenzene;diiodozinc has a molecular weight of 463.77 g/mol, XLogP of 4.56, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-fluoro-3-methylbenzene;diiodozinc is sourced from PubChem (CID 174784139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).