C8H9ClFN — CID 138495185
3-chloro-2-fluoro-N,N-dimethylaniline (PubChem CID 138495185) has the molecular formula C8H9ClFN and a molecular weight of 173.62 g/mol. Its IUPAC name is 3-chloro-2-fluoro-N,N-dimethylaniline.
| Compound Name | 3-chloro-2-fluoro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 138495185 |
| Molecular Formula | C8H9ClFN |
| Molecular Weight | 173.62 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | 3-chloro-2-fluoro-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(Cl)c1F |
| InChI | InChI=1S/C8H9ClFN/c1-11(2)7-5-3-4-6(9)8(7)10/h3-5H,1-2H3 |
| InChIKey | JWXSCRHOXDSGRM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.62 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |